C15H24N4O2 — CID 83090356
3-[(3-tert-butyl-1-methylpyrazol-4-yl)methylamino]-1-methylpiperidine-2,6-dione (PubChem CID 83090356) has the molecular formula C15H24N4O2 and a molecular weight of 292.38 g/mol. Its IUPAC name is 3-[(3-tert-butyl-1-methylpyrazol-4-yl)methylamino]-1-methylpiperidine-2,6-dione.
| Compound Name | 3-[(3-tert-butyl-1-methylpyrazol-4-yl)methylamino]-1-methylpiperidine-2,6-dione |
|---|---|
| PubChem CID | 83090356 |
| Molecular Formula | C15H24N4O2 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.19 |
| IUPAC Name | 3-[(3-tert-butyl-1-methylpyrazol-4-yl)methylamino]-1-methylpiperidine-2,6-dione |
| SMILES | CN1C(=O)CCC(NCc2cn(C)nc2C(C)(C)C)C1=O |
| InChI | InChI=1S/C15H24N4O2/c1-15(2,3)13-10(9-18(4)17-13)8-16-11-6-7-12(20)19(5)14(11)21/h9,11,16H,6-8H2,1-5H3 |
| InChIKey | VUPBVKCAUQYJIT-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|