C14H17ClN2O4 — CID 104663909
3-[(5-chloro-2-hydroxy-3-methoxyphenyl)methylamino]-1-methylpiperidine-2,6-dione (PubChem CID 104663909) has the molecular formula C14H17ClN2O4 and a molecular weight of 312.75 g/mol. Its IUPAC name is 3-[(5-chloro-2-hydroxy-3-methoxyphenyl)methylamino]-1-methylpiperidine-2,6-dione.
| Compound Name | 3-[(5-chloro-2-hydroxy-3-methoxyphenyl)methylamino]-1-methylpiperidine-2,6-dione |
|---|---|
| PubChem CID | 104663909 |
| Molecular Formula | C14H17ClN2O4 |
| Molecular Weight | 312.75 g/mol |
| Exact Mass | 312.09 |
| IUPAC Name | 3-[(5-chloro-2-hydroxy-3-methoxyphenyl)methylamino]-1-methylpiperidine-2,6-dione |
| SMILES | COc1cc(Cl)cc(CNC2CCC(=O)N(C)C2=O)c1O |
| InChI | InChI=1S/C14H17ClN2O4/c1-17-12(18)4-3-10(14(17)20)16-7-8-5-9(15)6-11(21-2)13(8)19/h5-6,10,16,19H,3-4,7H2,1-2H3 |
| InChIKey | CDONKKILFJRIKT-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.75 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|