C10H16N2O5 — CID 103255545
3-hydroxy-4-[(1-methyl-2,6-dioxopiperidin-3-yl)amino]butanoic acid (PubChem CID 103255545) has the molecular formula C10H16N2O5 and a molecular weight of 244.25 g/mol. Its IUPAC name is 3-hydroxy-4-[(1-methyl-2,6-dioxopiperidin-3-yl)amino]butanoic acid.
| Compound Name | 3-hydroxy-4-[(1-methyl-2,6-dioxopiperidin-3-yl)amino]butanoic acid |
|---|---|
| PubChem CID | 103255545 |
| Molecular Formula | C10H16N2O5 |
| Molecular Weight | 244.25 g/mol |
| Exact Mass | 244.11 |
| IUPAC Name | 3-hydroxy-4-[(1-methyl-2,6-dioxopiperidin-3-yl)amino]butanoic acid |
| SMILES | CN1C(=O)CCC(NCC(O)CC(=O)O)C1=O |
| InChI | InChI=1S/C10H16N2O5/c1-12-8(14)3-2-7(10(12)17)11-5-6(13)4-9(15)16/h6-7,11,13H,2-5H2,1H3,(H,15,16) |
| InChIKey | JTFJVCKZMZSKLD-UHFFFAOYSA-N |
| XLogP | -1.44 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.25 |
| LogP ≤ 5 | -1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|