About 1-[2-[(1-methyl-2,6-dioxopiperidin-3-yl)amino]ethyl]triazole-4-carboxylic acid
1-[2-[(1-methyl-2,6-dioxopiperidin-3-yl)amino]ethyl]triazole-4-carboxylic acid (PubChem CID 103255513) has the molecular formula C11H15N5O4
and a molecular weight of 281.27 g/mol. Its IUPAC name is 1-[2-[(1-methyl-2,6-dioxopiperidin-3-yl)amino]ethyl]triazole-4-carboxylic acid.
Molecular Properties
| Compound Name | 1-[2-[(1-methyl-2,6-dioxopiperidin-3-yl)amino]ethyl]triazole-4-carboxylic acid |
| PubChem CID | 103255513 |
| Molecular Formula | C11H15N5O4 |
| Molecular Weight | 281.27 g/mol |
| Exact Mass | 281.11 |
| IUPAC Name | 1-[2-[(1-methyl-2,6-dioxopiperidin-3-yl)amino]ethyl]triazole-4-carboxylic acid |
| SMILES | CN1C(=O)CCC(NCCn2cc(C(=O)O)nn2)C1=O |
| InChI | InChI=1S/C11H15N5O4/c1-15-9(17)3-2-7(10(15)18)12-4-5-16-6-8(11(19)20)13-14-16/h6-7,12H,2-5H2,1H3,(H,19,20) |
| InChIKey | HNAOKOUADUVKPN-UHFFFAOYSA-N |
| XLogP | -1.29 |
| TPSA | 117.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.27 |
| LogP ≤ 5 | -1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 1-[2-[(1-methyl-2,6-dioxopiperidin-3-yl)amino]ethyl]triazole-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-[(1-methyl-2,6-dioxopiperidin-3-yl)amino]ethyl]triazole-4-carboxylic acid?
The IUPAC name of 1-[2-[(1-methyl-2,6-dioxopiperidin-3-yl)amino]ethyl]triazole-4-carboxylic acid (CID 103255513) is 1-[2-[(1-methyl-2,6-dioxopiperidin-3-yl)amino]ethyl]triazole-4-carboxylic acid.
What is the SMILES notation for 1-[2-[(1-methyl-2,6-dioxopiperidin-3-yl)amino]ethyl]triazole-4-carboxylic acid?
The canonical SMILES for 1-[2-[(1-methyl-2,6-dioxopiperidin-3-yl)amino]ethyl]triazole-4-carboxylic acid is CN1C(=O)CCC(NCCn2cc(C(=O)O)nn2)C1=O.
What is the InChIKey of 1-[2-[(1-methyl-2,6-dioxopiperidin-3-yl)amino]ethyl]triazole-4-carboxylic acid?
The InChIKey is HNAOKOUADUVKPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15N5O4/c1-15-9(17)3-2-7(10(15)18)12-4-5-16-6-8(11(19)20)13-14-16/h6-7,12H,2-5H2,1H3,(H,19,20).
What are the key properties of 1-[2-[(1-methyl-2,6-dioxopiperidin-3-yl)amino]ethyl]triazole-4-carboxylic acid?
1-[2-[(1-methyl-2,6-dioxopiperidin-3-yl)amino]ethyl]triazole-4-carboxylic acid has a molecular weight of 281.27 g/mol, XLogP of -1.29, 5 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-[(1-methyl-2,6-dioxopiperidin-3-yl)amino]ethyl]triazole-4-carboxylic acid is sourced from PubChem (CID 103255513), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).