About 5-[(1-methyl-2,6-dioxopiperidin-3-yl)amino]pyridine-2-carboxylic acid
5-[(1-methyl-2,6-dioxopiperidin-3-yl)amino]pyridine-2-carboxylic acid (PubChem CID 113435928) has the molecular formula C12H13N3O4
and a molecular weight of 263.25 g/mol. Its IUPAC name is 5-[(1-methyl-2,6-dioxopiperidin-3-yl)amino]pyridine-2-carboxylic acid.
Molecular Properties
| Compound Name | 5-[(1-methyl-2,6-dioxopiperidin-3-yl)amino]pyridine-2-carboxylic acid |
| PubChem CID | 113435928 |
| Molecular Formula | C12H13N3O4 |
| Molecular Weight | 263.25 g/mol |
| Exact Mass | 263.09 |
| IUPAC Name | 5-[(1-methyl-2,6-dioxopiperidin-3-yl)amino]pyridine-2-carboxylic acid |
| SMILES | CN1C(=O)CCC(Nc2ccc(C(=O)O)nc2)C1=O |
| InChI | InChI=1S/C12H13N3O4/c1-15-10(16)5-4-8(11(15)17)14-7-2-3-9(12(18)19)13-6-7/h2-3,6,8,14H,4-5H2,1H3,(H,18,19) |
| InChIKey | HJOGOQRKAFFDKP-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 99.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.25 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 5-[(1-methyl-2,6-dioxopiperidin-3-yl)amino]pyridine-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(1-methyl-2,6-dioxopiperidin-3-yl)amino]pyridine-2-carboxylic acid?
The IUPAC name of 5-[(1-methyl-2,6-dioxopiperidin-3-yl)amino]pyridine-2-carboxylic acid (CID 113435928) is 5-[(1-methyl-2,6-dioxopiperidin-3-yl)amino]pyridine-2-carboxylic acid.
What is the SMILES notation for 5-[(1-methyl-2,6-dioxopiperidin-3-yl)amino]pyridine-2-carboxylic acid?
The canonical SMILES for 5-[(1-methyl-2,6-dioxopiperidin-3-yl)amino]pyridine-2-carboxylic acid is CN1C(=O)CCC(Nc2ccc(C(=O)O)nc2)C1=O.
What is the InChIKey of 5-[(1-methyl-2,6-dioxopiperidin-3-yl)amino]pyridine-2-carboxylic acid?
The InChIKey is HJOGOQRKAFFDKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13N3O4/c1-15-10(16)5-4-8(11(15)17)14-7-2-3-9(12(18)19)13-6-7/h2-3,6,8,14H,4-5H2,1H3,(H,18,19).
What are the key properties of 5-[(1-methyl-2,6-dioxopiperidin-3-yl)amino]pyridine-2-carboxylic acid?
5-[(1-methyl-2,6-dioxopiperidin-3-yl)amino]pyridine-2-carboxylic acid has a molecular weight of 263.25 g/mol, XLogP of 0.34, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(1-methyl-2,6-dioxopiperidin-3-yl)amino]pyridine-2-carboxylic acid is sourced from PubChem (CID 113435928), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).