C13H18N4O3 — CID 66326323
3-[(6-ethoxy-2-methylpyrimidin-4-yl)amino]-1-methylpiperidine-2,6-dione (PubChem CID 66326323) has the molecular formula C13H18N4O3 and a molecular weight of 278.31 g/mol. Its IUPAC name is 3-[(6-ethoxy-2-methylpyrimidin-4-yl)amino]-1-methylpiperidine-2,6-dione.
| Compound Name | 3-[(6-ethoxy-2-methylpyrimidin-4-yl)amino]-1-methylpiperidine-2,6-dione |
|---|---|
| PubChem CID | 66326323 |
| Molecular Formula | C13H18N4O3 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | 3-[(6-ethoxy-2-methylpyrimidin-4-yl)amino]-1-methylpiperidine-2,6-dione |
| SMILES | CCOc1cc(NC2CCC(=O)N(C)C2=O)nc(C)n1 |
| InChI | InChI=1S/C13H18N4O3/c1-4-20-11-7-10(14-8(2)15-11)16-9-5-6-12(18)17(3)13(9)19/h7,9H,4-6H2,1-3H3,(H,14,15,16) |
| InChIKey | MXKSRCQYHCZFHD-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|