C11H16N6O2 — CID 80924688
3-[(6-hydrazinyl-2-methylpyrimidin-4-yl)amino]-1-methylpiperidine-2,6-dione (PubChem CID 80924688) has the molecular formula C11H16N6O2 and a molecular weight of 264.29 g/mol. Its IUPAC name is 3-[(6-hydrazinyl-2-methylpyrimidin-4-yl)amino]-1-methylpiperidine-2,6-dione.
| Compound Name | 3-[(6-hydrazinyl-2-methylpyrimidin-4-yl)amino]-1-methylpiperidine-2,6-dione |
|---|---|
| PubChem CID | 80924688 |
| Molecular Formula | C11H16N6O2 |
| Molecular Weight | 264.29 g/mol |
| Exact Mass | 264.13 |
| IUPAC Name | 3-[(6-hydrazinyl-2-methylpyrimidin-4-yl)amino]-1-methylpiperidine-2,6-dione |
| SMILES | Cc1nc(NN)cc(NC2CCC(=O)N(C)C2=O)n1 |
| InChI | InChI=1S/C11H16N6O2/c1-6-13-8(5-9(14-6)16-12)15-7-3-4-10(18)17(2)11(7)19/h5,7H,3-4,12H2,1-2H3,(H2,13,14,15,16) |
| InChIKey | QYPFTTWWOMLFRJ-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 113.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.29 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|