C12H17N5O2 — CID 80856243
3-[(6-amino-2,5-dimethylpyrimidin-4-yl)amino]-1-methylpiperidine-2,6-dione (PubChem CID 80856243) has the molecular formula C12H17N5O2 and a molecular weight of 263.30 g/mol. Its IUPAC name is 3-[(6-amino-2,5-dimethylpyrimidin-4-yl)amino]-1-methylpiperidine-2,6-dione.
| Compound Name | 3-[(6-amino-2,5-dimethylpyrimidin-4-yl)amino]-1-methylpiperidine-2,6-dione |
|---|---|
| PubChem CID | 80856243 |
| Molecular Formula | C12H17N5O2 |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.14 |
| IUPAC Name | 3-[(6-amino-2,5-dimethylpyrimidin-4-yl)amino]-1-methylpiperidine-2,6-dione |
| SMILES | Cc1nc(N)c(C)c(NC2CCC(=O)N(C)C2=O)n1 |
| InChI | InChI=1S/C12H17N5O2/c1-6-10(13)14-7(2)15-11(6)16-8-4-5-9(18)17(3)12(8)19/h8H,4-5H2,1-3H3,(H3,13,14,15,16) |
| InChIKey | VNRJGYVQXDOIST-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 101.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|