C12H17N5O3S — CID 116671038
4-amino-2-(dimethylamino)-N-(1-methyl-2,6-dioxopiperidin-3-yl)-1,3-thiazole-5-carboxamide (PubChem CID 116671038) has the molecular formula C12H17N5O3S and a molecular weight of 311.37 g/mol. Its IUPAC name is 4-amino-2-(dimethylamino)-N-(1-methyl-2,6-dioxopiperidin-3-yl)-1,3-thiazole-5-carboxamide.
| Compound Name | 4-amino-2-(dimethylamino)-N-(1-methyl-2,6-dioxopiperidin-3-yl)-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 116671038 |
| Molecular Formula | C12H17N5O3S |
| Molecular Weight | 311.37 g/mol |
| Exact Mass | 311.11 |
| IUPAC Name | 4-amino-2-(dimethylamino)-N-(1-methyl-2,6-dioxopiperidin-3-yl)-1,3-thiazole-5-carboxamide |
| SMILES | CN1C(=O)CCC(NC(=O)c2sc(N(C)C)nc2N)C1=O |
| InChI | InChI=1S/C12H17N5O3S/c1-16(2)12-15-9(13)8(21-12)10(19)14-6-4-5-7(18)17(3)11(6)20/h6H,4-5,13H2,1-3H3,(H,14,19) |
| InChIKey | CAWJSAPTDWBOTC-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 108.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.37 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|