C13H16N4O3 — CID 136976212
3-[(2-cyclopropyl-6-oxo-1H-pyrimidin-4-yl)amino]-1-methylpiperidine-2,6-dione (PubChem CID 136976212) has the molecular formula C13H16N4O3 and a molecular weight of 276.30 g/mol. Its IUPAC name is 3-[(2-cyclopropyl-6-oxo-1H-pyrimidin-4-yl)amino]-1-methylpiperidine-2,6-dione.
| Compound Name | 3-[(2-cyclopropyl-6-oxo-1H-pyrimidin-4-yl)amino]-1-methylpiperidine-2,6-dione |
|---|---|
| PubChem CID | 136976212 |
| Molecular Formula | C13H16N4O3 |
| Molecular Weight | 276.30 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | 3-[(2-cyclopropyl-6-oxo-1H-pyrimidin-4-yl)amino]-1-methylpiperidine-2,6-dione |
| SMILES | CN1C(=O)CCC(Nc2cc(=O)[nH]c(C3CC3)n2)C1=O |
| InChI | InChI=1S/C13H16N4O3/c1-17-11(19)5-4-8(13(17)20)14-9-6-10(18)16-12(15-9)7-2-3-7/h6-8H,2-5H2,1H3,(H2,14,15,16,18) |
| InChIKey | NEJYTFMSSUTTEM-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 95.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.30 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|