C12H19N5O3 — CID 103242627
1-[2-[(4-carbamoylcyclohexyl)amino]ethyl]triazole-4-carboxylic acid (PubChem CID 103242627) has the molecular formula C12H19N5O3 and a molecular weight of 281.32 g/mol. Its IUPAC name is 1-[2-[(4-carbamoylcyclohexyl)amino]ethyl]triazole-4-carboxylic acid.
| Compound Name | 1-[2-[(4-carbamoylcyclohexyl)amino]ethyl]triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 103242627 |
| Molecular Formula | C12H19N5O3 |
| Molecular Weight | 281.32 g/mol |
| Exact Mass | 281.15 |
| IUPAC Name | 1-[2-[(4-carbamoylcyclohexyl)amino]ethyl]triazole-4-carboxylic acid |
| SMILES | NC(=O)C1CCC(NCCn2cc(C(=O)O)nn2)CC1 |
| InChI | InChI=1S/C12H19N5O3/c13-11(18)8-1-3-9(4-2-8)14-5-6-17-7-10(12(19)20)15-16-17/h7-9,14H,1-6H2,(H2,13,18)(H,19,20) |
| InChIKey | QPGVYPXNHXHWSZ-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 123.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.32 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |