C13H15N3O5 — CID 79321740
1-[2-[(1-methyl-2,6-dioxopiperidin-3-yl)amino]-2-oxoethyl]pyrrole-2-carboxylic acid (PubChem CID 79321740) has the molecular formula C13H15N3O5 and a molecular weight of 293.28 g/mol. Its IUPAC name is 1-[2-[(1-methyl-2,6-dioxopiperidin-3-yl)amino]-2-oxoethyl]pyrrole-2-carboxylic acid.
| Compound Name | 1-[2-[(1-methyl-2,6-dioxopiperidin-3-yl)amino]-2-oxoethyl]pyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 79321740 |
| Molecular Formula | C13H15N3O5 |
| Molecular Weight | 293.28 g/mol |
| Exact Mass | 293.10 |
| IUPAC Name | 1-[2-[(1-methyl-2,6-dioxopiperidin-3-yl)amino]-2-oxoethyl]pyrrole-2-carboxylic acid |
| SMILES | CN1C(=O)CCC(NC(=O)Cn2cccc2C(=O)O)C1=O |
| InChI | InChI=1S/C13H15N3O5/c1-15-11(18)5-4-8(12(15)19)14-10(17)7-16-6-2-3-9(16)13(20)21/h2-3,6,8H,4-5,7H2,1H3,(H,14,17)(H,20,21) |
| InChIKey | VUOQHMSGEFMDFI-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 108.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.28 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|