C13H13BrN2O3S — CID 107031626
4-bromo-N-(1-methyl-2,6-dioxopiperidin-3-yl)-2-sulfanylbenzamide (PubChem CID 107031626) has the molecular formula C13H13BrN2O3S and a molecular weight of 357.23 g/mol. Its IUPAC name is 4-bromo-N-(1-methyl-2,6-dioxopiperidin-3-yl)-2-sulfanylbenzamide.
| Compound Name | 4-bromo-N-(1-methyl-2,6-dioxopiperidin-3-yl)-2-sulfanylbenzamide |
|---|---|
| PubChem CID | 107031626 |
| Molecular Formula | C13H13BrN2O3S |
| Molecular Weight | 357.23 g/mol |
| Exact Mass | 355.98 |
| IUPAC Name | 4-bromo-N-(1-methyl-2,6-dioxopiperidin-3-yl)-2-sulfanylbenzamide |
| SMILES | CN1C(=O)CCC(NC(=O)c2ccc(Br)cc2S)C1=O |
| InChI | InChI=1S/C13H13BrN2O3S/c1-16-11(17)5-4-9(13(16)19)15-12(18)8-3-2-7(14)6-10(8)20/h2-3,6,9,20H,4-5H2,1H3,(H,15,18) |
| InChIKey | GTEDCZAERHJRDH-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.23 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|