About 4-bromo-N-(1-methyl-2,6-dioxopiperidin-3-yl)-2-sulfanylbenzamide
4-bromo-N-(1-methyl-2,6-dioxopiperidin-3-yl)-2-sulfanylbenzamide (PubChem CID 107031626) has the molecular formula C13H13BrN2O3S
and a molecular weight of 357.23 g/mol. Its IUPAC name is 4-bromo-N-(1-methyl-2,6-dioxopiperidin-3-yl)-2-sulfanylbenzamide.
Molecular Properties
| Compound Name | 4-bromo-N-(1-methyl-2,6-dioxopiperidin-3-yl)-2-sulfanylbenzamide |
| PubChem CID | 107031626 |
| Molecular Formula | C13H13BrN2O3S |
| Molecular Weight | 357.23 g/mol |
| Exact Mass | 355.98 |
| IUPAC Name | 4-bromo-N-(1-methyl-2,6-dioxopiperidin-3-yl)-2-sulfanylbenzamide |
| SMILES | CN1C(=O)CCC(NC(=O)c2ccc(Br)cc2S)C1=O |
| InChI | InChI=1S/C13H13BrN2O3S/c1-16-11(17)5-4-9(13(16)19)15-12(18)8-3-2-7(14)6-10(8)20/h2-3,6,9,20H,4-5H2,1H3,(H,15,18) |
| InChIKey | GTEDCZAERHJRDH-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.23 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 4-bromo-N-(1-methyl-2,6-dioxopiperidin-3-yl)-2-sulfanylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-N-(1-methyl-2,6-dioxopiperidin-3-yl)-2-sulfanylbenzamide?
The IUPAC name of 4-bromo-N-(1-methyl-2,6-dioxopiperidin-3-yl)-2-sulfanylbenzamide (CID 107031626) is 4-bromo-N-(1-methyl-2,6-dioxopiperidin-3-yl)-2-sulfanylbenzamide.
What is the SMILES notation for 4-bromo-N-(1-methyl-2,6-dioxopiperidin-3-yl)-2-sulfanylbenzamide?
The canonical SMILES for 4-bromo-N-(1-methyl-2,6-dioxopiperidin-3-yl)-2-sulfanylbenzamide is CN1C(=O)CCC(NC(=O)c2ccc(Br)cc2S)C1=O.
What is the InChIKey of 4-bromo-N-(1-methyl-2,6-dioxopiperidin-3-yl)-2-sulfanylbenzamide?
The InChIKey is GTEDCZAERHJRDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13BrN2O3S/c1-16-11(17)5-4-9(13(16)19)15-12(18)8-3-2-7(14)6-10(8)20/h2-3,6,9,20H,4-5H2,1H3,(H,15,18).
What are the key properties of 4-bromo-N-(1-methyl-2,6-dioxopiperidin-3-yl)-2-sulfanylbenzamide?
4-bromo-N-(1-methyl-2,6-dioxopiperidin-3-yl)-2-sulfanylbenzamide has a molecular weight of 357.23 g/mol, XLogP of 1.62, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-N-(1-methyl-2,6-dioxopiperidin-3-yl)-2-sulfanylbenzamide is sourced from PubChem (CID 107031626), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).