C8H6BrClO2S — CID 156570528
1-(5-bromo-4-chlorothiophen-2-yl)butane-1,3-dione (PubChem CID 156570528) has the molecular formula C8H6BrClO2S and a molecular weight of 281.56 g/mol. Its IUPAC name is 1-(5-bromo-4-chlorothiophen-2-yl)butane-1,3-dione.
| Compound Name | 1-(5-bromo-4-chlorothiophen-2-yl)butane-1,3-dione |
|---|---|
| PubChem CID | 156570528 |
| Molecular Formula | C8H6BrClO2S |
| Molecular Weight | 281.56 g/mol |
| Exact Mass | 279.90 |
| IUPAC Name | 1-(5-bromo-4-chlorothiophen-2-yl)butane-1,3-dione |
| SMILES | CC(=O)CC(=O)c1cc(Cl)c(Br)s1 |
| InChI | InChI=1S/C8H6BrClO2S/c1-4(11)2-6(12)7-3-5(10)8(9)13-7/h3H,2H2,1H3 |
| InChIKey | LODPKXNUXGJQHH-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.56 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|