C17H24ClN3O2S — CID 100620923
methyl 2-chloro-5-(3-piperidin-1-ylpropylcarbamothioylamino)benzoate (PubChem CID 100620923) has the molecular formula C17H24ClN3O2S and a molecular weight of 369.92 g/mol. Its IUPAC name is methyl 2-chloro-5-(3-piperidin-1-ylpropylcarbamothioylamino)benzoate.
| Compound Name | methyl 2-chloro-5-(3-piperidin-1-ylpropylcarbamothioylamino)benzoate |
|---|---|
| PubChem CID | 100620923 |
| Molecular Formula | C17H24ClN3O2S |
| Molecular Weight | 369.92 g/mol |
| Exact Mass | 369.13 |
| IUPAC Name | methyl 2-chloro-5-(3-piperidin-1-ylpropylcarbamothioylamino)benzoate |
| SMILES | COC(=O)c1cc(NC(=S)NCCCN2CCCCC2)ccc1Cl |
| InChI | InChI=1S/C17H24ClN3O2S/c1-23-16(22)14-12-13(6-7-15(14)18)20-17(24)19-8-5-11-21-9-3-2-4-10-21/h6-7,12H,2-5,8-11H2,1H3,(H2,19,20,24) |
| InChIKey | PPXJZCBWJXWJIW-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.92 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|