C15H12ClN2O3- — CID 7657756
3-[(4-chlorophenyl)carbamoylamino]-4-methylbenzoate (PubChem CID 7657756) has the molecular formula C15H12ClN2O3- and a molecular weight of 303.73 g/mol. Its IUPAC name is 3-[(4-chlorophenyl)carbamoylamino]-4-methylbenzoate.
| Compound Name | 3-[(4-chlorophenyl)carbamoylamino]-4-methylbenzoate |
|---|---|
| PubChem CID | 7657756 |
| Molecular Formula | C15H12ClN2O3- |
| Molecular Weight | 303.73 g/mol |
| Exact Mass | 303.05 |
| IUPAC Name | 3-[(4-chlorophenyl)carbamoylamino]-4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)[O-])cc1NC(=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H13ClN2O3/c1-9-2-3-10(14(19)20)8-13(9)18-15(21)17-12-6-4-11(16)5-7-12/h2-8H,1H3,(H,19,20)(H2,17,18,21)/p-1 |
| InChIKey | TZQQIVZBPZUVLT-UHFFFAOYSA-M |
| XLogP | 2.66 |
| TPSA | 81.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.73 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |