C12H17N3O3 — CID 4191656
ethyl N-[(2,6-dimethylphenyl)carbamoylamino]carbamate (PubChem CID 4191656) has the molecular formula C12H17N3O3 and a molecular weight of 251.29 g/mol. Its IUPAC name is ethyl N-[(2,6-dimethylphenyl)carbamoylamino]carbamate.
| Compound Name | ethyl N-[(2,6-dimethylphenyl)carbamoylamino]carbamate |
|---|---|
| PubChem CID | 4191656 |
| Molecular Formula | C12H17N3O3 |
| Molecular Weight | 251.29 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | ethyl N-[(2,6-dimethylphenyl)carbamoylamino]carbamate |
| SMILES | CCOC(=O)NNC(=O)Nc1c(C)cccc1C |
| InChI | InChI=1S/C12H17N3O3/c1-4-18-12(17)15-14-11(16)13-10-8(2)6-5-7-9(10)3/h5-7H,4H2,1-3H3,(H,15,17)(H2,13,14,16) |
| InChIKey | SDFACAKWDJAPHB-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.29 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|