C21H24N4O5S — CID 4506431
N-[4-[[[2-(2-methoxyphenoxy)acetyl]carbamothioylamino]carbamoyl]phenyl]butanamide (PubChem CID 4506431) has the molecular formula C21H24N4O5S and a molecular weight of 444.51 g/mol. Its IUPAC name is N-[4-[[[2-(2-methoxyphenoxy)acetyl]carbamothioylamino]carbamoyl]phenyl]butanamide.
| Compound Name | N-[4-[[[2-(2-methoxyphenoxy)acetyl]carbamothioylamino]carbamoyl]phenyl]butanamide |
|---|---|
| PubChem CID | 4506431 |
| Molecular Formula | C21H24N4O5S |
| Molecular Weight | 444.51 g/mol |
| Exact Mass | 444.15 |
| IUPAC Name | N-[4-[[[2-(2-methoxyphenoxy)acetyl]carbamothioylamino]carbamoyl]phenyl]butanamide |
| SMILES | CCCC(=O)Nc1ccc(C(=O)NNC(=S)NC(=O)COc2ccccc2OC)cc1 |
| InChI | InChI=1S/C21H24N4O5S/c1-3-6-18(26)22-15-11-9-14(10-12-15)20(28)24-25-21(31)23-19(27)13-30-17-8-5-4-7-16(17)29-2/h4-5,7-12H,3,6,13H2,1-2H3,(H,22,26)(H,24,28)(H2,23,25,27,31) |
| InChIKey | FXOQGEIIXYBMEY-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 117.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.51 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|