C20H20Br2N4O4S — CID 4505741
N-[4-[[[2-(2,4-dibromophenoxy)acetyl]carbamothioylamino]carbamoyl]phenyl]butanamide (PubChem CID 4505741) has the molecular formula C20H20Br2N4O4S and a molecular weight of 572.28 g/mol. Its IUPAC name is N-[4-[[[2-(2,4-dibromophenoxy)acetyl]carbamothioylamino]carbamoyl]phenyl]butanamide.
| Compound Name | N-[4-[[[2-(2,4-dibromophenoxy)acetyl]carbamothioylamino]carbamoyl]phenyl]butanamide |
|---|---|
| PubChem CID | 4505741 |
| Molecular Formula | C20H20Br2N4O4S |
| Molecular Weight | 572.28 g/mol |
| Exact Mass | 569.96 |
| IUPAC Name | N-[4-[[[2-(2,4-dibromophenoxy)acetyl]carbamothioylamino]carbamoyl]phenyl]butanamide |
| SMILES | CCCC(=O)Nc1ccc(C(=O)NNC(=S)NC(=O)COc2ccc(Br)cc2Br)cc1 |
| InChI | InChI=1S/C20H20Br2N4O4S/c1-2-3-17(27)23-14-7-4-12(5-8-14)19(29)25-26-20(31)24-18(28)11-30-16-9-6-13(21)10-15(16)22/h4-10H,2-3,11H2,1H3,(H,23,27)(H,25,29)(H2,24,26,28,31) |
| InChIKey | GCTNSPOFPRFYSC-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 108.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.28 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|