C23H28BrN3O4 — CID 17189704
N-[4-[[[2-(2-bromo-4-butan-2-ylphenoxy)acetyl]amino]carbamoyl]phenyl]butanamide (PubChem CID 17189704) has the molecular formula C23H28BrN3O4 and a molecular weight of 490.40 g/mol. Its IUPAC name is N-[4-[[[2-(2-bromo-4-butan-2-ylphenoxy)acetyl]amino]carbamoyl]phenyl]butanamide.
| Compound Name | N-[4-[[[2-(2-bromo-4-butan-2-ylphenoxy)acetyl]amino]carbamoyl]phenyl]butanamide |
|---|---|
| PubChem CID | 17189704 |
| Molecular Formula | C23H28BrN3O4 |
| Molecular Weight | 490.40 g/mol |
| Exact Mass | 489.13 |
| IUPAC Name | N-[4-[[[2-(2-bromo-4-butan-2-ylphenoxy)acetyl]amino]carbamoyl]phenyl]butanamide |
| SMILES | CCCC(=O)Nc1ccc(C(=O)NNC(=O)COc2ccc(C(C)CC)cc2Br)cc1 |
| InChI | InChI=1S/C23H28BrN3O4/c1-4-6-21(28)25-18-10-7-16(8-11-18)23(30)27-26-22(29)14-31-20-12-9-17(13-19(20)24)15(3)5-2/h7-13,15H,4-6,14H2,1-3H3,(H,25,28)(H,26,29)(H,27,30) |
| InChIKey | KYBHYBOBDPXABC-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.40 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|