C25H34BrN3O3 — CID 17229859
4-[[2-(2-bromo-4-butan-2-ylphenoxy)acetyl]amino]-N-[2-(diethylamino)ethyl]benzamide (PubChem CID 17229859) has the molecular formula C25H34BrN3O3 and a molecular weight of 504.47 g/mol. Its IUPAC name is 4-[[2-(2-bromo-4-butan-2-ylphenoxy)acetyl]amino]-N-[2-(diethylamino)ethyl]benzamide.
| Compound Name | 4-[[2-(2-bromo-4-butan-2-ylphenoxy)acetyl]amino]-N-[2-(diethylamino)ethyl]benzamide |
|---|---|
| PubChem CID | 17229859 |
| Molecular Formula | C25H34BrN3O3 |
| Molecular Weight | 504.47 g/mol |
| Exact Mass | 503.18 |
| IUPAC Name | 4-[[2-(2-bromo-4-butan-2-ylphenoxy)acetyl]amino]-N-[2-(diethylamino)ethyl]benzamide |
| SMILES | CCC(C)c1ccc(OCC(=O)Nc2ccc(C(=O)NCCN(CC)CC)cc2)c(Br)c1 |
| InChI | InChI=1S/C25H34BrN3O3/c1-5-18(4)20-10-13-23(22(26)16-20)32-17-24(30)28-21-11-8-19(9-12-21)25(31)27-14-15-29(6-2)7-3/h8-13,16,18H,5-7,14-15,17H2,1-4H3,(H,27,31)(H,28,30) |
| InChIKey | DAZZBTKBLJMQKU-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.47 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |