C18H24N4O3S3 — CID 100539032
3-(4-methylpiperidin-1-yl)sulfonyl-N-(5-propylsulfanyl-1,3,4-thiadiazol-2-yl)benzamide (PubChem CID 100539032) has the molecular formula C18H24N4O3S3 and a molecular weight of 440.62 g/mol. Its IUPAC name is 3-(4-methylpiperidin-1-yl)sulfonyl-N-(5-propylsulfanyl-1,3,4-thiadiazol-2-yl)benzamide.
| Compound Name | 3-(4-methylpiperidin-1-yl)sulfonyl-N-(5-propylsulfanyl-1,3,4-thiadiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 100539032 |
| Molecular Formula | C18H24N4O3S3 |
| Molecular Weight | 440.62 g/mol |
| Exact Mass | 440.10 |
| IUPAC Name | 3-(4-methylpiperidin-1-yl)sulfonyl-N-(5-propylsulfanyl-1,3,4-thiadiazol-2-yl)benzamide |
| SMILES | CCCSc1nnc(NC(=O)c2cccc(S(=O)(=O)N3CCC(C)CC3)c2)s1 |
| InChI | InChI=1S/C18H24N4O3S3/c1-3-11-26-18-21-20-17(27-18)19-16(23)14-5-4-6-15(12-14)28(24,25)22-9-7-13(2)8-10-22/h4-6,12-13H,3,7-11H2,1-2H3,(H,19,20,23) |
| InChIKey | FZIGFHHPBVHNDP-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.62 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|