C18H21N5O2S2 — CID 135785417
N-(5-butylsulfanyl-1,3,4-thiadiazol-2-yl)-3-(2-hydroxy-4,6-dimethylphenyl)-1H-pyrazole-5-carboxamide (PubChem CID 135785417) has the molecular formula C18H21N5O2S2 and a molecular weight of 403.53 g/mol. Its IUPAC name is N-(5-butylsulfanyl-1,3,4-thiadiazol-2-yl)-3-(2-hydroxy-4,6-dimethylphenyl)-1H-pyrazole-5-carboxamide.
| Compound Name | N-(5-butylsulfanyl-1,3,4-thiadiazol-2-yl)-3-(2-hydroxy-4,6-dimethylphenyl)-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 135785417 |
| Molecular Formula | C18H21N5O2S2 |
| Molecular Weight | 403.53 g/mol |
| Exact Mass | 403.11 |
| IUPAC Name | N-(5-butylsulfanyl-1,3,4-thiadiazol-2-yl)-3-(2-hydroxy-4,6-dimethylphenyl)-1H-pyrazole-5-carboxamide |
| SMILES | CCCCSc1nnc(NC(=O)c2cc(-c3c(C)cc(C)cc3O)n[nH]2)s1 |
| InChI | InChI=1S/C18H21N5O2S2/c1-4-5-6-26-18-23-22-17(27-18)19-16(25)13-9-12(20-21-13)15-11(3)7-10(2)8-14(15)24/h7-9,24H,4-6H2,1-3H3,(H,20,21)(H,19,22,25) |
| InChIKey | BBHAJTRQEWMBSO-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 103.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.53 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|