C24H14ClFN4O3S2 — CID 2469388
2-(2-chlorophenyl)-N-[5-[(4-fluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-1,3-dioxoisoindole-5-carboxamide (PubChem CID 2469388) has the molecular formula C24H14ClFN4O3S2 and a molecular weight of 524.99 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-N-[5-[(4-fluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-1,3-dioxoisoindole-5-carboxamide.
| Compound Name | 2-(2-chlorophenyl)-N-[5-[(4-fluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-1,3-dioxoisoindole-5-carboxamide |
|---|---|
| PubChem CID | 2469388 |
| Molecular Formula | C24H14ClFN4O3S2 |
| Molecular Weight | 524.99 g/mol |
| Exact Mass | 524.02 |
| IUPAC Name | 2-(2-chlorophenyl)-N-[5-[(4-fluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-1,3-dioxoisoindole-5-carboxamide |
| SMILES | O=C(Nc1nnc(SCc2ccc(F)cc2)s1)c1ccc2c(c1)C(=O)N(c1ccccc1Cl)C2=O |
| InChI | InChI=1S/C24H14ClFN4O3S2/c25-18-3-1-2-4-19(18)30-21(32)16-10-7-14(11-17(16)22(30)33)20(31)27-23-28-29-24(35-23)34-12-13-5-8-15(26)9-6-13/h1-11H,12H2,(H,27,28,31) |
| InChIKey | ZLAKCTBRPLYECP-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.99 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|