C22H23ClN4O3S3 — CID 100752530
3-(azepan-1-ylsulfonyl)-N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-4-chlorobenzamide (PubChem CID 100752530) has the molecular formula C22H23ClN4O3S3 and a molecular weight of 523.11 g/mol. Its IUPAC name is 3-(azepan-1-ylsulfonyl)-N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-4-chlorobenzamide.
| Compound Name | 3-(azepan-1-ylsulfonyl)-N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-4-chlorobenzamide |
|---|---|
| PubChem CID | 100752530 |
| Molecular Formula | C22H23ClN4O3S3 |
| Molecular Weight | 523.11 g/mol |
| Exact Mass | 522.06 |
| IUPAC Name | 3-(azepan-1-ylsulfonyl)-N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-4-chlorobenzamide |
| SMILES | O=C(Nc1nnc(SCc2ccccc2)s1)c1ccc(Cl)c(S(=O)(=O)N2CCCCCC2)c1 |
| InChI | InChI=1S/C22H23ClN4O3S3/c23-18-11-10-17(14-19(18)33(29,30)27-12-6-1-2-7-13-27)20(28)24-21-25-26-22(32-21)31-15-16-8-4-3-5-9-16/h3-5,8-11,14H,1-2,6-7,12-13,15H2,(H,24,25,28) |
| InChIKey | DKIZOKKLQSMZOP-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.11 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|