C15H17BrN4O3S3 — CID 2203626
4-bromo-N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-3-pyrrolidin-1-ylsulfonylbenzamide (PubChem CID 2203626) has the molecular formula C15H17BrN4O3S3 and a molecular weight of 477.43 g/mol. Its IUPAC name is 4-bromo-N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-3-pyrrolidin-1-ylsulfonylbenzamide.
| Compound Name | 4-bromo-N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-3-pyrrolidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 2203626 |
| Molecular Formula | C15H17BrN4O3S3 |
| Molecular Weight | 477.43 g/mol |
| Exact Mass | 475.96 |
| IUPAC Name | 4-bromo-N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-3-pyrrolidin-1-ylsulfonylbenzamide |
| SMILES | CCSc1nnc(NC(=O)c2ccc(Br)c(S(=O)(=O)N3CCCC3)c2)s1 |
| InChI | InChI=1S/C15H17BrN4O3S3/c1-2-24-15-19-18-14(25-15)17-13(21)10-5-6-11(16)12(9-10)26(22,23)20-7-3-4-8-20/h5-6,9H,2-4,7-8H2,1H3,(H,17,18,21) |
| InChIKey | UMMPNQQJAFDQAE-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.43 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|