C22H24ClN5O4S3 — CID 3369333
3-[4-(3-chlorophenyl)piperazin-1-yl]sulfonyl-N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-4-methoxybenzamide (PubChem CID 3369333) has the molecular formula C22H24ClN5O4S3 and a molecular weight of 554.12 g/mol. Its IUPAC name is 3-[4-(3-chlorophenyl)piperazin-1-yl]sulfonyl-N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-4-methoxybenzamide.
| Compound Name | 3-[4-(3-chlorophenyl)piperazin-1-yl]sulfonyl-N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-4-methoxybenzamide |
|---|---|
| PubChem CID | 3369333 |
| Molecular Formula | C22H24ClN5O4S3 |
| Molecular Weight | 554.12 g/mol |
| Exact Mass | 553.07 |
| IUPAC Name | 3-[4-(3-chlorophenyl)piperazin-1-yl]sulfonyl-N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-4-methoxybenzamide |
| SMILES | CCSc1nnc(NC(=O)c2ccc(OC)c(S(=O)(=O)N3CCN(c4cccc(Cl)c4)CC3)c2)s1 |
| InChI | InChI=1S/C22H24ClN5O4S3/c1-3-33-22-26-25-21(34-22)24-20(29)15-7-8-18(32-2)19(13-15)35(30,31)28-11-9-27(10-12-28)17-6-4-5-16(23)14-17/h4-8,13-14H,3,9-12H2,1-2H3,(H,24,25,29) |
| InChIKey | GPPWPEMPVGERRP-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.12 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|