C17H17Cl3N2O3S — CID 1210841
1-(3-chlorophenyl)-4-(2,3-dichloro-4-methoxyphenyl)sulfonylpiperazine (PubChem CID 1210841) has the molecular formula C17H17Cl3N2O3S and a molecular weight of 435.76 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-4-(2,3-dichloro-4-methoxyphenyl)sulfonylpiperazine.
| Compound Name | 1-(3-chlorophenyl)-4-(2,3-dichloro-4-methoxyphenyl)sulfonylpiperazine |
|---|---|
| PubChem CID | 1210841 |
| Molecular Formula | C17H17Cl3N2O3S |
| Molecular Weight | 435.76 g/mol |
| Exact Mass | 434.00 |
| IUPAC Name | 1-(3-chlorophenyl)-4-(2,3-dichloro-4-methoxyphenyl)sulfonylpiperazine |
| SMILES | COc1ccc(S(=O)(=O)N2CCN(c3cccc(Cl)c3)CC2)c(Cl)c1Cl |
| InChI | InChI=1S/C17H17Cl3N2O3S/c1-25-14-5-6-15(17(20)16(14)19)26(23,24)22-9-7-21(8-10-22)13-4-2-3-12(18)11-13/h2-6,11H,7-10H2,1H3 |
| InChIKey | ZXPIYNQHRHZPEC-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.76 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |