C20H25ClN2O2S — CID 997461
1-(3-chlorophenyl)-4-(2,3,5,6-tetramethylphenyl)sulfonylpiperazine (PubChem CID 997461) has the molecular formula C20H25ClN2O2S and a molecular weight of 392.95 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-4-(2,3,5,6-tetramethylphenyl)sulfonylpiperazine.
| Compound Name | 1-(3-chlorophenyl)-4-(2,3,5,6-tetramethylphenyl)sulfonylpiperazine |
|---|---|
| PubChem CID | 997461 |
| Molecular Formula | C20H25ClN2O2S |
| Molecular Weight | 392.95 g/mol |
| Exact Mass | 392.13 |
| IUPAC Name | 1-(3-chlorophenyl)-4-(2,3,5,6-tetramethylphenyl)sulfonylpiperazine |
| SMILES | Cc1cc(C)c(C)c(S(=O)(=O)N2CCN(c3cccc(Cl)c3)CC2)c1C |
| InChI | InChI=1S/C20H25ClN2O2S/c1-14-12-15(2)17(4)20(16(14)3)26(24,25)23-10-8-22(9-11-23)19-7-5-6-18(21)13-19/h5-7,12-13H,8-11H2,1-4H3 |
| InChIKey | WZLJFJGHYIJWPV-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.95 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |