C21H22ClN3O5S — CID 100621888
1-[5-[4-(3-chlorophenyl)piperazin-1-yl]sulfonyl-2-methoxyphenyl]pyrrolidine-2,5-dione (PubChem CID 100621888) has the molecular formula C21H22ClN3O5S and a molecular weight of 463.94 g/mol. Its IUPAC name is 1-[5-[4-(3-chlorophenyl)piperazin-1-yl]sulfonyl-2-methoxyphenyl]pyrrolidine-2,5-dione.
| Compound Name | 1-[5-[4-(3-chlorophenyl)piperazin-1-yl]sulfonyl-2-methoxyphenyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 100621888 |
| Molecular Formula | C21H22ClN3O5S |
| Molecular Weight | 463.94 g/mol |
| Exact Mass | 463.10 |
| IUPAC Name | 1-[5-[4-(3-chlorophenyl)piperazin-1-yl]sulfonyl-2-methoxyphenyl]pyrrolidine-2,5-dione |
| SMILES | COc1ccc(S(=O)(=O)N2CCN(c3cccc(Cl)c3)CC2)cc1N1C(=O)CCC1=O |
| InChI | InChI=1S/C21H22ClN3O5S/c1-30-19-6-5-17(14-18(19)25-20(26)7-8-21(25)27)31(28,29)24-11-9-23(10-12-24)16-4-2-3-15(22)13-16/h2-6,13-14H,7-12H2,1H3 |
| InChIKey | AKPMEEKKIQDSSV-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 87.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.94 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|