C20H22N4O4S3 — CID 16593022
N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-4-methoxy-3-(propan-2-ylsulfamoyl)benzamide (PubChem CID 16593022) has the molecular formula C20H22N4O4S3 and a molecular weight of 478.62 g/mol. Its IUPAC name is N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-4-methoxy-3-(propan-2-ylsulfamoyl)benzamide.
| Compound Name | N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-4-methoxy-3-(propan-2-ylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 16593022 |
| Molecular Formula | C20H22N4O4S3 |
| Molecular Weight | 478.62 g/mol |
| Exact Mass | 478.08 |
| IUPAC Name | N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-4-methoxy-3-(propan-2-ylsulfamoyl)benzamide |
| SMILES | COc1ccc(C(=O)Nc2nnc(SCc3ccccc3)s2)cc1S(=O)(=O)NC(C)C |
| InChI | InChI=1S/C20H22N4O4S3/c1-13(2)24-31(26,27)17-11-15(9-10-16(17)28-3)18(25)21-19-22-23-20(30-19)29-12-14-7-5-4-6-8-14/h4-11,13,24H,12H2,1-3H3,(H,21,22,25) |
| InChIKey | ACPWMRSOCQHPRM-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 110.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.62 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|