C19H17ClN4O3S2 — CID 92546648
4-chloro-N-(5-phenyl-1,3,4-thiadiazol-2-yl)-3-pyrrolidin-1-ylsulfonylbenzamide (PubChem CID 92546648) has the molecular formula C19H17ClN4O3S2 and a molecular weight of 448.96 g/mol. Its IUPAC name is 4-chloro-N-(5-phenyl-1,3,4-thiadiazol-2-yl)-3-pyrrolidin-1-ylsulfonylbenzamide.
| Compound Name | 4-chloro-N-(5-phenyl-1,3,4-thiadiazol-2-yl)-3-pyrrolidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 92546648 |
| Molecular Formula | C19H17ClN4O3S2 |
| Molecular Weight | 448.96 g/mol |
| Exact Mass | 448.04 |
| IUPAC Name | 4-chloro-N-(5-phenyl-1,3,4-thiadiazol-2-yl)-3-pyrrolidin-1-ylsulfonylbenzamide |
| SMILES | O=C(Nc1nnc(-c2ccccc2)s1)c1ccc(Cl)c(S(=O)(=O)N2CCCC2)c1 |
| InChI | InChI=1S/C19H17ClN4O3S2/c20-15-9-8-14(12-16(15)29(26,27)24-10-4-5-11-24)17(25)21-19-23-22-18(28-19)13-6-2-1-3-7-13/h1-3,6-9,12H,4-5,10-11H2,(H,21,23,25) |
| InChIKey | JHNZBXNFNWMJGY-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.96 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |