C21H11FN4O3S2 — CID 108744002
2-(4-fluorophenyl)-1,3-dioxo-N-(5-thiophen-2-yl-1,3,4-thiadiazol-2-yl)isoindole-5-carboxamide (PubChem CID 108744002) has the molecular formula C21H11FN4O3S2 and a molecular weight of 450.48 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-1,3-dioxo-N-(5-thiophen-2-yl-1,3,4-thiadiazol-2-yl)isoindole-5-carboxamide.
| Compound Name | 2-(4-fluorophenyl)-1,3-dioxo-N-(5-thiophen-2-yl-1,3,4-thiadiazol-2-yl)isoindole-5-carboxamide |
|---|---|
| PubChem CID | 108744002 |
| Molecular Formula | C21H11FN4O3S2 |
| Molecular Weight | 450.48 g/mol |
| Exact Mass | 450.03 |
| IUPAC Name | 2-(4-fluorophenyl)-1,3-dioxo-N-(5-thiophen-2-yl-1,3,4-thiadiazol-2-yl)isoindole-5-carboxamide |
| SMILES | O=C(Nc1nnc(-c2cccs2)s1)c1ccc2c(c1)C(=O)N(c1ccc(F)cc1)C2=O |
| InChI | InChI=1S/C21H11FN4O3S2/c22-12-4-6-13(7-5-12)26-19(28)14-8-3-11(10-15(14)20(26)29)17(27)23-21-25-24-18(31-21)16-2-1-9-30-16/h1-10H,(H,23,25,27) |
| InChIKey | YLZHNVUIJRXZMH-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.48 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|