C18H14N4O3S2 — CID 108766321
1,3-dioxo-2-propan-2-yl-N-(5-thiophen-2-yl-1,3,4-thiadiazol-2-yl)isoindole-5-carboxamide (PubChem CID 108766321) has the molecular formula C18H14N4O3S2 and a molecular weight of 398.47 g/mol. Its IUPAC name is 1,3-dioxo-2-propan-2-yl-N-(5-thiophen-2-yl-1,3,4-thiadiazol-2-yl)isoindole-5-carboxamide.
| Compound Name | 1,3-dioxo-2-propan-2-yl-N-(5-thiophen-2-yl-1,3,4-thiadiazol-2-yl)isoindole-5-carboxamide |
|---|---|
| PubChem CID | 108766321 |
| Molecular Formula | C18H14N4O3S2 |
| Molecular Weight | 398.47 g/mol |
| Exact Mass | 398.05 |
| IUPAC Name | 1,3-dioxo-2-propan-2-yl-N-(5-thiophen-2-yl-1,3,4-thiadiazol-2-yl)isoindole-5-carboxamide |
| SMILES | CC(C)N1C(=O)c2ccc(C(=O)Nc3nnc(-c4cccs4)s3)cc2C1=O |
| InChI | InChI=1S/C18H14N4O3S2/c1-9(2)22-16(24)11-6-5-10(8-12(11)17(22)25)14(23)19-18-21-20-15(27-18)13-4-3-7-26-13/h3-9H,1-2H3,(H,19,21,23) |
| InChIKey | FHLMBDPJZYIMPZ-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.47 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|