C14H14N6OS3 — CID 90510075
N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-2-[(6-methyl-2-pyridinyl)amino]-1,3-thiazole-4-carboxamide (PubChem CID 90510075) has the molecular formula C14H14N6OS3 and a molecular weight of 378.51 g/mol. Its IUPAC name is N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-2-[(6-methyl-2-pyridinyl)amino]-1,3-thiazole-4-carboxamide.
| Compound Name | N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-2-[(6-methyl-2-pyridinyl)amino]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 90510075 |
| Molecular Formula | C14H14N6OS3 |
| Molecular Weight | 378.51 g/mol |
| Exact Mass | 378.04 |
| IUPAC Name | N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-2-[(6-methyl-2-pyridinyl)amino]-1,3-thiazole-4-carboxamide |
| SMILES | CCSc1nnc(NC(=O)c2csc(Nc3cccc(C)n3)n2)s1 |
| InChI | InChI=1S/C14H14N6OS3/c1-3-22-14-20-19-13(24-14)18-11(21)9-7-23-12(16-9)17-10-6-4-5-8(2)15-10/h4-7H,3H2,1-2H3,(H,15,16,17)(H,18,19,21) |
| InChIKey | VOPRTMHBFNAJJX-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 92.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.51 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|