C21H22N4O3S — CID 90510030
butyl 4-[[2-[(6-methyl-2-pyridinyl)amino]-1,3-thiazole-4-carbonyl]amino]benzoate (PubChem CID 90510030) has the molecular formula C21H22N4O3S and a molecular weight of 410.50 g/mol. Its IUPAC name is butyl 4-[[2-[(6-methyl-2-pyridinyl)amino]-1,3-thiazole-4-carbonyl]amino]benzoate.
| Compound Name | butyl 4-[[2-[(6-methyl-2-pyridinyl)amino]-1,3-thiazole-4-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 90510030 |
| Molecular Formula | C21H22N4O3S |
| Molecular Weight | 410.50 g/mol |
| Exact Mass | 410.14 |
| IUPAC Name | butyl 4-[[2-[(6-methyl-2-pyridinyl)amino]-1,3-thiazole-4-carbonyl]amino]benzoate |
| SMILES | CCCCOC(=O)c1ccc(NC(=O)c2csc(Nc3cccc(C)n3)n2)cc1 |
| InChI | InChI=1S/C21H22N4O3S/c1-3-4-12-28-20(27)15-8-10-16(11-9-15)23-19(26)17-13-29-21(24-17)25-18-7-5-6-14(2)22-18/h5-11,13H,3-4,12H2,1-2H3,(H,23,26)(H,22,24,25) |
| InChIKey | XJPMQMSDTSCSHT-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.50 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|