C24H26N4O4S — CID 16897208
butyl 4-[[4-methyl-2-[(3-methylphenyl)carbamoylamino]-1,3-thiazole-5-carbonyl]amino]benzoate (PubChem CID 16897208) has the molecular formula C24H26N4O4S and a molecular weight of 466.56 g/mol. Its IUPAC name is butyl 4-[[4-methyl-2-[(3-methylphenyl)carbamoylamino]-1,3-thiazole-5-carbonyl]amino]benzoate.
| Compound Name | butyl 4-[[4-methyl-2-[(3-methylphenyl)carbamoylamino]-1,3-thiazole-5-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 16897208 |
| Molecular Formula | C24H26N4O4S |
| Molecular Weight | 466.56 g/mol |
| Exact Mass | 466.17 |
| IUPAC Name | butyl 4-[[4-methyl-2-[(3-methylphenyl)carbamoylamino]-1,3-thiazole-5-carbonyl]amino]benzoate |
| SMILES | CCCCOC(=O)c1ccc(NC(=O)c2sc(NC(=O)Nc3cccc(C)c3)nc2C)cc1 |
| InChI | InChI=1S/C24H26N4O4S/c1-4-5-13-32-22(30)17-9-11-18(12-10-17)26-21(29)20-16(3)25-24(33-20)28-23(31)27-19-8-6-7-15(2)14-19/h6-12,14H,4-5,13H2,1-3H3,(H,26,29)(H2,25,27,28,31) |
| InChIKey | JZGYDYRMTNXXPS-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 109.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.56 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|