C22H22FN3O5S2 — CID 16944561
butyl 4-[[2-[(4-fluorophenyl)sulfonylamino]-4-methyl-1,3-thiazole-5-carbonyl]amino]benzoate (PubChem CID 16944561) has the molecular formula C22H22FN3O5S2 and a molecular weight of 491.57 g/mol. Its IUPAC name is butyl 4-[[2-[(4-fluorophenyl)sulfonylamino]-4-methyl-1,3-thiazole-5-carbonyl]amino]benzoate.
| Compound Name | butyl 4-[[2-[(4-fluorophenyl)sulfonylamino]-4-methyl-1,3-thiazole-5-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 16944561 |
| Molecular Formula | C22H22FN3O5S2 |
| Molecular Weight | 491.57 g/mol |
| Exact Mass | 491.10 |
| IUPAC Name | butyl 4-[[2-[(4-fluorophenyl)sulfonylamino]-4-methyl-1,3-thiazole-5-carbonyl]amino]benzoate |
| SMILES | CCCCOC(=O)c1ccc(NC(=O)c2sc(NS(=O)(=O)c3ccc(F)cc3)nc2C)cc1 |
| InChI | InChI=1S/C22H22FN3O5S2/c1-3-4-13-31-21(28)15-5-9-17(10-6-15)25-20(27)19-14(2)24-22(32-19)26-33(29,30)18-11-7-16(23)8-12-18/h5-12H,3-4,13H2,1-2H3,(H,24,26)(H,25,27) |
| InChIKey | SLYUWPALMMVINU-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 114.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.57 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|