C15H15N5OS3 — CID 30940480
2-(2-anilino-1,3-thiazol-4-yl)-N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)acetamide (PubChem CID 30940480) has the molecular formula C15H15N5OS3 and a molecular weight of 377.52 g/mol. Its IUPAC name is 2-(2-anilino-1,3-thiazol-4-yl)-N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)acetamide.
| Compound Name | 2-(2-anilino-1,3-thiazol-4-yl)-N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 30940480 |
| Molecular Formula | C15H15N5OS3 |
| Molecular Weight | 377.52 g/mol |
| Exact Mass | 377.04 |
| IUPAC Name | 2-(2-anilino-1,3-thiazol-4-yl)-N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)acetamide |
| SMILES | CCSc1nnc(NC(=O)Cc2csc(Nc3ccccc3)n2)s1 |
| InChI | InChI=1S/C15H15N5OS3/c1-2-22-15-20-19-14(24-15)18-12(21)8-11-9-23-13(17-11)16-10-6-4-3-5-7-10/h3-7,9H,2,8H2,1H3,(H,16,17)(H,18,19,21) |
| InChIKey | XODYVBXKPSUTHC-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 79.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.52 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|