C16H15N5O2S3 — CID 7191195
N-[5-[2-[(4-methyl-1,3-thiazol-2-yl)amino]-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-2-phenylacetamide (PubChem CID 7191195) has the molecular formula C16H15N5O2S3 and a molecular weight of 405.53 g/mol. Its IUPAC name is N-[5-[2-[(4-methyl-1,3-thiazol-2-yl)amino]-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-2-phenylacetamide.
| Compound Name | N-[5-[2-[(4-methyl-1,3-thiazol-2-yl)amino]-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-2-phenylacetamide |
|---|---|
| PubChem CID | 7191195 |
| Molecular Formula | C16H15N5O2S3 |
| Molecular Weight | 405.53 g/mol |
| Exact Mass | 405.04 |
| IUPAC Name | N-[5-[2-[(4-methyl-1,3-thiazol-2-yl)amino]-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-2-phenylacetamide |
| SMILES | Cc1csc(NC(=O)CSc2nnc(NC(=O)Cc3ccccc3)s2)n1 |
| InChI | InChI=1S/C16H15N5O2S3/c1-10-8-24-14(17-10)19-13(23)9-25-16-21-20-15(26-16)18-12(22)7-11-5-3-2-4-6-11/h2-6,8H,7,9H2,1H3,(H,17,19,23)(H,18,20,22) |
| InChIKey | CHUOLPHBHNMAQU-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 96.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.53 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|