C15H14N4OS4 — CID 9484056
N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-2-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]acetamide (PubChem CID 9484056) has the molecular formula C15H14N4OS4 and a molecular weight of 394.57 g/mol. Its IUPAC name is N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-2-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]acetamide.
| Compound Name | N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-2-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 9484056 |
| Molecular Formula | C15H14N4OS4 |
| Molecular Weight | 394.57 g/mol |
| Exact Mass | 394.01 |
| IUPAC Name | N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-2-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]acetamide |
| SMILES | Cc1csc(SCC(=O)Nc2nnc(SCc3ccccc3)s2)n1 |
| InChI | InChI=1S/C15H14N4OS4/c1-10-7-21-14(16-10)23-9-12(20)17-13-18-19-15(24-13)22-8-11-5-3-2-4-6-11/h2-7H,8-9H2,1H3,(H,17,18,20) |
| InChIKey | VSSMWDGBZAVZOP-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.57 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|