C20H18N6OS3 — CID 43043806
N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-2-[[4-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 43043806) has the molecular formula C20H18N6OS3 and a molecular weight of 454.61 g/mol. Its IUPAC name is N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-2-[[4-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-2-[[4-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 43043806 |
| Molecular Formula | C20H18N6OS3 |
| Molecular Weight | 454.61 g/mol |
| Exact Mass | 454.07 |
| IUPAC Name | N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-2-[[4-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | Cc1ccc(-n2cnnc2SCC(=O)Nc2nnc(SCc3ccccc3)s2)cc1 |
| InChI | InChI=1S/C20H18N6OS3/c1-14-7-9-16(10-8-14)26-13-21-24-19(26)28-12-17(27)22-18-23-25-20(30-18)29-11-15-5-3-2-4-6-15/h2-10,13H,11-12H2,1H3,(H,22,23,27) |
| InChIKey | JFLKUPZADZUIJT-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 85.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.61 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|