C22H20N4OS3 — CID 4857721
N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-2-[2-methyl-4-(4-methylphenyl)-1,3-thiazol-5-yl]acetamide (PubChem CID 4857721) has the molecular formula C22H20N4OS3 and a molecular weight of 452.63 g/mol. Its IUPAC name is N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-2-[2-methyl-4-(4-methylphenyl)-1,3-thiazol-5-yl]acetamide.
| Compound Name | N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-2-[2-methyl-4-(4-methylphenyl)-1,3-thiazol-5-yl]acetamide |
|---|---|
| PubChem CID | 4857721 |
| Molecular Formula | C22H20N4OS3 |
| Molecular Weight | 452.63 g/mol |
| Exact Mass | 452.08 |
| IUPAC Name | N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-2-[2-methyl-4-(4-methylphenyl)-1,3-thiazol-5-yl]acetamide |
| SMILES | Cc1ccc(-c2nc(C)sc2CC(=O)Nc2nnc(SCc3ccccc3)s2)cc1 |
| InChI | InChI=1S/C22H20N4OS3/c1-14-8-10-17(11-9-14)20-18(29-15(2)23-20)12-19(27)24-21-25-26-22(30-21)28-13-16-6-4-3-5-7-16/h3-11H,12-13H2,1-2H3,(H,24,25,27) |
| InChIKey | OSYUVGFHCHVJJD-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.63 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|