C18H14FN7OS3 — CID 18874241
N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-2-[1-(4-fluorophenyl)tetrazol-5-yl]sulfanylacetamide (PubChem CID 18874241) has the molecular formula C18H14FN7OS3 and a molecular weight of 459.56 g/mol. Its IUPAC name is N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-2-[1-(4-fluorophenyl)tetrazol-5-yl]sulfanylacetamide.
| Compound Name | N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-2-[1-(4-fluorophenyl)tetrazol-5-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 18874241 |
| Molecular Formula | C18H14FN7OS3 |
| Molecular Weight | 459.56 g/mol |
| Exact Mass | 459.04 |
| IUPAC Name | N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-2-[1-(4-fluorophenyl)tetrazol-5-yl]sulfanylacetamide |
| SMILES | O=C(CSc1nnnn1-c1ccc(F)cc1)Nc1nnc(SCc2ccccc2)s1 |
| InChI | InChI=1S/C18H14FN7OS3/c19-13-6-8-14(9-7-13)26-17(22-24-25-26)28-11-15(27)20-16-21-23-18(30-16)29-10-12-4-2-1-3-5-12/h1-9H,10-11H2,(H,20,21,27) |
| InChIKey | HZXFVIWGUBPMIZ-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 98.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.56 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|