C14H13ClN6OS3 — CID 9458707
N-[5-[(4-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]acetamide (PubChem CID 9458707) has the molecular formula C14H13ClN6OS3 and a molecular weight of 412.95 g/mol. Its IUPAC name is N-[5-[(4-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]acetamide.
| Compound Name | N-[5-[(4-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 9458707 |
| Molecular Formula | C14H13ClN6OS3 |
| Molecular Weight | 412.95 g/mol |
| Exact Mass | 412.00 |
| IUPAC Name | N-[5-[(4-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]acetamide |
| SMILES | Cn1cnnc1SCC(=O)Nc1nnc(SCc2ccc(Cl)cc2)s1 |
| InChI | InChI=1S/C14H13ClN6OS3/c1-21-8-16-19-13(21)23-7-11(22)17-12-18-20-14(25-12)24-6-9-2-4-10(15)5-3-9/h2-5,8H,6-7H2,1H3,(H,17,18,22) |
| InChIKey | WSWHGVBNKGPHSK-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 85.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.95 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|