C21H20N4O5S2 — CID 40832775
N-[5-[2-(4-acetylanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-3,4-dimethoxybenzamide (PubChem CID 40832775) has the molecular formula C21H20N4O5S2 and a molecular weight of 472.55 g/mol. Its IUPAC name is N-[5-[2-(4-acetylanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-3,4-dimethoxybenzamide.
| Compound Name | N-[5-[2-(4-acetylanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-3,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 40832775 |
| Molecular Formula | C21H20N4O5S2 |
| Molecular Weight | 472.55 g/mol |
| Exact Mass | 472.09 |
| IUPAC Name | N-[5-[2-(4-acetylanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-3,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)Nc2nnc(SCC(=O)Nc3ccc(C(C)=O)cc3)s2)cc1OC |
| InChI | InChI=1S/C21H20N4O5S2/c1-12(26)13-4-7-15(8-5-13)22-18(27)11-31-21-25-24-20(32-21)23-19(28)14-6-9-16(29-2)17(10-14)30-3/h4-10H,11H2,1-3H3,(H,22,27)(H,23,24,28) |
| InChIKey | SHSVBFZTSUAWCT-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 119.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.55 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|