C19H16BrClN4O4S2 — CID 44956852
5-bromo-2-chloro-N-[5-[2-(2,5-dimethoxyanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]benzamide (PubChem CID 44956852) has the molecular formula C19H16BrClN4O4S2 and a molecular weight of 543.85 g/mol. Its IUPAC name is 5-bromo-2-chloro-N-[5-[2-(2,5-dimethoxyanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]benzamide.
| Compound Name | 5-bromo-2-chloro-N-[5-[2-(2,5-dimethoxyanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 44956852 |
| Molecular Formula | C19H16BrClN4O4S2 |
| Molecular Weight | 543.85 g/mol |
| Exact Mass | 541.95 |
| IUPAC Name | 5-bromo-2-chloro-N-[5-[2-(2,5-dimethoxyanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]benzamide |
| SMILES | COc1ccc(OC)c(NC(=O)CSc2nnc(NC(=O)c3cc(Br)ccc3Cl)s2)c1 |
| InChI | InChI=1S/C19H16BrClN4O4S2/c1-28-11-4-6-15(29-2)14(8-11)22-16(26)9-30-19-25-24-18(31-19)23-17(27)12-7-10(20)3-5-13(12)21/h3-8H,9H2,1-2H3,(H,22,26)(H,23,24,27) |
| InChIKey | OXZWDEGNEZZNBF-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 102.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.85 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|