C21H22N4O2S2 — CID 42388441
N-[5-[2-(naphthalen-1-ylamino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]cyclohexanecarboxamide (PubChem CID 42388441) has the molecular formula C21H22N4O2S2 and a molecular weight of 426.57 g/mol. Its IUPAC name is N-[5-[2-(naphthalen-1-ylamino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]cyclohexanecarboxamide.
| Compound Name | N-[5-[2-(naphthalen-1-ylamino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 42388441 |
| Molecular Formula | C21H22N4O2S2 |
| Molecular Weight | 426.57 g/mol |
| Exact Mass | 426.12 |
| IUPAC Name | N-[5-[2-(naphthalen-1-ylamino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]cyclohexanecarboxamide |
| SMILES | O=C(CSc1nnc(NC(=O)C2CCCCC2)s1)Nc1cccc2ccccc12 |
| InChI | InChI=1S/C21H22N4O2S2/c26-18(22-17-12-6-10-14-7-4-5-11-16(14)17)13-28-21-25-24-20(29-21)23-19(27)15-8-2-1-3-9-15/h4-7,10-12,15H,1-3,8-9,13H2,(H,22,26)(H,23,24,27) |
| InChIKey | GSOYUFNWVWMKII-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.57 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|