C19H14N4O2S3 — CID 40833327
N-[5-[2-(naphthalen-1-ylamino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]thiophene-2-carboxamide (PubChem CID 40833327) has the molecular formula C19H14N4O2S3 and a molecular weight of 426.55 g/mol. Its IUPAC name is N-[5-[2-(naphthalen-1-ylamino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]thiophene-2-carboxamide.
| Compound Name | N-[5-[2-(naphthalen-1-ylamino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 40833327 |
| Molecular Formula | C19H14N4O2S3 |
| Molecular Weight | 426.55 g/mol |
| Exact Mass | 426.03 |
| IUPAC Name | N-[5-[2-(naphthalen-1-ylamino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]thiophene-2-carboxamide |
| SMILES | O=C(CSc1nnc(NC(=O)c2cccs2)s1)Nc1cccc2ccccc12 |
| InChI | InChI=1S/C19H14N4O2S3/c24-16(20-14-8-3-6-12-5-1-2-7-13(12)14)11-27-19-23-22-18(28-19)21-17(25)15-9-4-10-26-15/h1-10H,11H2,(H,20,24)(H,21,22,25) |
| InChIKey | JYHBGPQWOWTGQM-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.55 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|