C12H11N5O2S4 — CID 4168712
N-[5-[2-(4,5-dihydro-1,3-thiazol-2-ylamino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]thiophene-2-carboxamide (PubChem CID 4168712) has the molecular formula C12H11N5O2S4 and a molecular weight of 385.52 g/mol. Its IUPAC name is N-[5-[2-(4,5-dihydro-1,3-thiazol-2-ylamino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]thiophene-2-carboxamide.
| Compound Name | N-[5-[2-(4,5-dihydro-1,3-thiazol-2-ylamino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 4168712 |
| Molecular Formula | C12H11N5O2S4 |
| Molecular Weight | 385.52 g/mol |
| Exact Mass | 384.98 |
| IUPAC Name | N-[5-[2-(4,5-dihydro-1,3-thiazol-2-ylamino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]thiophene-2-carboxamide |
| SMILES | O=C(CSc1nnc(NC(=O)c2cccs2)s1)NC1=NCCS1 |
| InChI | InChI=1S/C12H11N5O2S4/c18-8(14-10-13-3-5-21-10)6-22-12-17-16-11(23-12)15-9(19)7-2-1-4-20-7/h1-2,4H,3,5-6H2,(H,13,14,18)(H,15,16,19) |
| InChIKey | XVKIJKASESPUDP-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 96.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.52 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|